| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:47:59 UTC |
|---|
| Update Date | 2025-03-21 18:01:36 UTC |
|---|
| HMDB ID | HMDB0304924 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033696 |
|---|
| Name | 5-Methylpyrogallol sulfate |
|---|
| Frequency | 107.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O6S |
|---|
| Molecular Mass | 220.0042 |
|---|
| SMILES | Cc1cc(O)c(O)c(OS(=O)(=O)O)c1 |
|---|
| InChI Key | VMOJNRFXEJSJDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesmeta cresolsorganic oxidesorganooxygen compoundspara cresolsphenoxy compoundssulfuric acid monoesterstoluenes |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterm-cresol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundp-cresolsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid estertolueneorganooxygen compound |
|---|
