| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:48:00 UTC |
|---|
| Update Date | 2025-03-21 18:01:36 UTC |
|---|
| HMDB ID | HMDB0129284 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033736 |
|---|
| Name | 3,5,7,8-tetrahydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one |
|---|
| Frequency | 107.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O8 |
|---|
| Molecular Mass | 332.0532 |
|---|
| SMILES | COc1cc(-c2oc3c(O)c(O)cc(O)c3c(=O)c2O)ccc1O |
|---|
| InChI Key | QBFAWRDCFGNKSP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3'-o-methylated flavonoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoids8-hydroxyflavonoidsalkyl aryl ethersanisoleschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | 3-hydroxyflavone8-hydroxyflavonoidphenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoidmethoxybenzene3p-methoxyflavonoid-skeletonoxacyclevinylogous acidorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
