| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:48:02 UTC |
|---|
| Update Date | 2025-03-21 18:01:37 UTC |
|---|
| HMDB ID | HMDB0247907 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033815 |
|---|
| Name | Acetic acid, (2,3,4-trichlorophenoxy)- |
|---|
| Frequency | 107.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H5Cl3O3 |
|---|
| Molecular Mass | 253.9304 |
|---|
| SMILES | O=C(O)COc1ccc(Cl)c(Cl)c1Cl |
|---|
| InChI Key | QMSFHWZMMPPKIR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | chlorophenoxyacetates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chloridescarbonyl compoundscarboxylic acidschlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | aryl chloridechlorobenzenephenol ethercarbonyl groupethercarboxylic acidorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundchlorophenoxyacetatehydrocarbon derivativehalobenzenephenoxy compoundorganooxygen compound |
|---|
