| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:48:05 UTC |
|---|
| Update Date | 2025-03-21 18:01:38 UTC |
|---|
| HMDB ID | HMDB0040585 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033942 |
|---|
| Name | (±)-Sulfobutanedioic acid |
|---|
| Frequency | 106.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H6O7S |
|---|
| Molecular Mass | 197.9834 |
|---|
| SMILES | O=C(O)CC(C(=O)O)S(=O)(=O)O |
|---|
| InChI Key | ULUAUXLGCMPNKK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | thia fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganosulfonic acidssulfonyls |
|---|
| Substituents | aliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidorganosulfonic acidorganosulfur compoundcarboxylic acid derivativeorganic oxidethia fatty acidsulfonylorganic oxygen compoundorganic sulfonic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
