| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:07 UTC |
|---|
| Update Date | 2025-03-21 18:01:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033996 |
|---|
| Frequency | 106.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7O7P |
|---|
| Molecular Mass | 245.9929 |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)OP(=O)(O)O |
|---|
| InChI Key | SJRLIKVUWDENHO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsacyl phosphatesbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compounds |
|---|
| Substituents | carboxylic acidbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
