| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:10 UTC |
|---|
| Update Date | 2025-03-21 18:01:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034137 |
|---|
| Frequency | 105.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O9P |
|---|
| Molecular Mass | 243.9984 |
|---|
| SMILES | O=C1OC(O)(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | KLOPVUDTHFJKCA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarboxylic acid estersgamma butyrolactoneshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl grouppentose phosphatecarboxylic acid derivativelactoneorganic oxidealiphatic heteromonocyclic compoundhemiacetalorganoheterocyclic compound1,2-diolalcoholtetrahydrofurangamma butyrolactoneoxacyclemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
