| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:11 UTC |
|---|
| Update Date | 2025-03-21 18:01:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034154 |
|---|
| Frequency | 105.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N2O6 |
|---|
| Molecular Mass | 286.1165 |
|---|
| SMILES | NC(=O)C1=CN(C2OC(CO)C(O)C(O)C2O)C=CC1 |
|---|
| InChI Key | IRNVBSZQRHMHJN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | n-substituted nicotinamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdihydropyridinesenamineshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholsprimary carboxylic acid amidessecondary alcoholsvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddihydropyridineoxaneprimary alcoholalcoholvinylogous amideazacyclecarboxamide groupn-substituted nicotinamideoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundenamine |
|---|