| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:14 UTC |
|---|
| Update Date | 2025-03-21 18:01:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034290 |
|---|
| Frequency | 105.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H4O7 |
|---|
| Molecular Mass | 187.9957 |
|---|
| SMILES | O=C1OC(C(O)C(=O)O)C(=O)C1=O |
|---|
| InChI Key | KTLUWBFUJWAVFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | dihydrofurans |
|---|
| Subclass | furanones |
|---|
| Direct Parent | furanones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarboxylic acid esterscarboxylic acidscyclic ketonesdicarboxylic acids and derivativesgamma butyrolactoneshydrocarbon derivativesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidtetrahydrofuranalpha-hydroxy acidcyclic ketonehydroxy acidcarboxylic acid derivativegamma butyrolactoneketonelactoneoxacycleorganic oxideorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivative3-furanoneorganooxygen compound |
|---|
