| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:15 UTC |
|---|
| Update Date | 2025-03-21 18:01:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034321 |
|---|
| Frequency | 104.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N2O10P |
|---|
| Molecular Mass | 354.0464 |
|---|
| SMILES | O=c1[nH]cc(C2OC(COP(=O)(O)O)C(O)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | SQRFWCOBIVWVJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | etherlactamaromatic heteromonocyclic compoundpyrimidonedialkyl etherpyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
