| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:16 UTC |
|---|
| Update Date | 2025-03-21 18:01:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034351 |
|---|
| Frequency | 126.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6N4O2S |
|---|
| Molecular Mass | 198.0211 |
|---|
| SMILES | Cn1c(=O)[nH]c2[nH]c(=S)[nH]c2c1=O |
|---|
| InChI Key | YTQUOFSGBFXRQN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidazolethioneslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspurinethionespyrimidonesthioureasvinylogous amides |
|---|
| Substituents | thiourealactamimidazole-2-thionepyrimidoneorganosulfur compoundpurinonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundazolevinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundpurinethioneorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
