| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:18 UTC |
|---|
| Update Date | 2025-03-21 18:01:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034461 |
|---|
| Frequency | 104.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O5S |
|---|
| Molecular Mass | 230.0249 |
|---|
| SMILES | Cc1ccc(C)c(C(=O)OS(=O)(=O)O)c1 |
|---|
| InChI Key | WYDPOXYWFSNAHF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssulfuric acid monoestersp-xylenes |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivativesbenzoylbenzoic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundxyleneorganic oxidemonocarboxylic acid or derivativesp-xyleneorganic oxygen compoundhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
