| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:19 UTC |
|---|
| Update Date | 2025-03-21 18:01:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034465 |
|---|
| Frequency | 104.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N3O4 |
|---|
| Molecular Mass | 213.075 |
|---|
| SMILES | Nc1ccn(C2CC(O)C(O)O2)c(=O)n1 |
|---|
| InChI Key | MZIQWGQHJFRMID-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundshemiacetalsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonic acid derivativearomatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundpyrimidoneoxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhemiacetalhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
