| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:48:19 UTC |
|---|
| Update Date | 2025-03-21 18:01:44 UTC |
|---|
| HMDB ID | HMDB0245546 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034498 |
|---|
| Name | 2',3'-Dideoxyguanosine |
|---|
| Frequency | 104.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N5O3 |
|---|
| Molecular Mass | 251.1018 |
|---|
| SMILES | Nc1nc2c(ncn2C2CCC(CO)O2)c(=O)[nH]1 |
|---|
| InChI Key | OCLZPNCLRLDXJC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidonestetrahydrofuransvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|