| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:23 UTC |
|---|
| Update Date | 2025-03-21 18:01:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034634 |
|---|
| Frequency | 103.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H12NO8P |
|---|
| Molecular Mass | 245.0301 |
|---|
| SMILES | NC(COP(=O)(O)O)C(O)C(O)C(=O)O |
|---|
| InChI Key | TWFADABZVBFYHV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfatty acids and conjugateshydrocarbon derivativesmonoalkyl phosphatesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidgamma amino acid or derivativesalpha-hydroxy acidmonosaccharidefatty acidphosphoethanolaminebeta-hydroxy acidsaccharideorganic oxideorganonitrogen compoundorganopnictogen compound1,2-diolalcoholhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
