| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:23 UTC |
|---|
| Update Date | 2025-03-21 18:01:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034654 |
|---|
| Frequency | 146.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N5O9P2S |
|---|
| Molecular Mass | 443.0066 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(O)(=S)OP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | LPUNOWSWFBIBQH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofuransthiophosphoric acid esters |
|---|
| Substituents | thiophosphoric acid estermonosaccharideimidazopyrimidinepyrimidineorganic thiophosphoric acid or derivativessaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|