| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:25 UTC |
|---|
| Update Date | 2025-03-21 18:01:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034708 |
|---|
| Frequency | 103.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7IO5S |
|---|
| Molecular Mass | 329.9059 |
|---|
| SMILES | COc1ccc(OS(=O)(=O)O)c(I)c1 |
|---|
| InChI Key | FUPUWSQOYOLFQI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaryl iodideshydrocarbon derivativesiodobenzenesmethoxybenzenesorganic oxidesorganoiodidesphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoesteretheralkyl aryl etherorganohalogen compoundiodobenzeneorganoiodidephenylsulfateorganic oxidemethoxybenzenearyl halidearomatic homomonocyclic compoundorganic oxygen compoundanisolesulfate-esterhydrocarbon derivativebenzenoidaryl iodidehalobenzenephenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
