| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:25 UTC |
|---|
| Update Date | 2025-03-21 18:01:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034715 |
|---|
| Frequency | 103.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O5 |
|---|
| Molecular Mass | 222.0528 |
|---|
| SMILES | COC(=O)c1ccccc1C(=O)OC(C)=O |
|---|
| InChI Key | NJXFXLAFPIEFCT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativesbenzyloxycarbonylscarbonyl compoundscarboxylic acid anhydrideshydrocarbon derivativesmethyl estersorganic oxidestricarboxylic acids and derivatives |
|---|
| Substituents | benzyloxycarbonylcarbonyl groupbenzoyltricarboxylic acid or derivativesbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemethyl esterorganic oxygen compoundcarboxylic acid estercarboxylic acid anhydridehydrocarbon derivativeorganooxygen compound |
|---|
