| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:26 UTC |
|---|
| Update Date | 2025-03-21 18:01:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034765 |
|---|
| Frequency | 485.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H4N4O3 |
|---|
| Molecular Mass | 192.0283 |
|---|
| SMILES | O=C(O)c1cnc2[nH]cnc(=O)c2n1 |
|---|
| InChI Key | RGPPWCNGINRDCN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrazine carboxylic acidspyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidecarboxylic acidazacycleheteroaromatic compoundpyrimidonepteridinecarboxylic acid derivativepyrimidineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundpyrazine carboxylic acidpyrazine carboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|