| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:27 UTC |
|---|
| Update Date | 2025-03-21 18:01:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034785 |
|---|
| Frequency | 103.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14ClN5O2 |
|---|
| Molecular Mass | 283.0836 |
|---|
| SMILES | N=C(NCCC(=O)O)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | YUNFZWNDYCXSFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | guanidines |
|---|
| Direct Parent | 1-arylbiguanides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesbeta amino acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidschlorobenzeneshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidimineorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxideorganopnictogen compound1-arylbiguanidearyl chloridechlorobenzenecarboximidamidebeta amino acid or derivativesaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|