| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:31 UTC |
|---|
| Update Date | 2025-03-21 18:01:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00034953 |
|---|
| Frequency | 102.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O5 |
|---|
| Molecular Mass | 220.0372 |
|---|
| SMILES | O=C(c1ccco1)c1c(O)cc(O)cc1O |
|---|
| InChI Key | UOHKSGVJYDJHME-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | aryl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl ketonesbenzoyl derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundsphloroglucinols and derivativesvinylogous acids |
|---|
| Substituents | furanmonocyclic benzene moietyfuroic acid or derivativesaromatic heteromonocyclic compoundbenzenetriolaryl-phenylketoneheteroaromatic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphloroglucinol derivativeoxacyclevinylogous acidorganic oxidephenolhydrocarbon derivativebenzenoidorganoheterocyclic compound |
|---|