| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:32 UTC |
|---|
| Update Date | 2025-03-21 18:01:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035022 |
|---|
| Frequency | 102.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O5 |
|---|
| Molecular Mass | 212.0685 |
|---|
| SMILES | COc1cc(OC)cc(C(O)C(=O)O)c1 |
|---|
| InChI Key | WVZWBFAZRSHDQA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | methoxybenzenes |
|---|
| Direct Parent | dimethoxybenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativesanisolesaromatic alcoholscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholphenol ethercarbonyl groupethercarboxylic acidalpha-hydroxy acidalkyl aryl ethercarboxylic acid derivativedimethoxybenzeneorganic oxidealcoholhydroxy acidaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundm-dimethoxybenzeneanisolesecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
