| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:39 UTC |
|---|
| Update Date | 2025-03-21 18:01:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035291 |
|---|
| Frequency | 101.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H4O7S |
|---|
| Molecular Mass | 207.9678 |
|---|
| SMILES | O=C(O)c1ccc(OS(=O)(=O)O)o1 |
|---|
| InChI Key | BIKASRKDNXUWIL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carboxylic acidsfuroic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundssulfuric acid monoesters |
|---|
| Substituents | furansulfuric acid monoesterfuroic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundheteroaromatic compoundcarboxylic acid derivativefuroic acidoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativearylsulfatesulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|