Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:48:40 UTC |
---|
Update Date | 2025-03-21 18:01:54 UTC |
---|
HMDB ID | HMDB0129964 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00035321 |
---|
Name | 2-(4-hydroxyphenyl)-1-(2,3,4,6-tetrahydroxyphenyl)propan-1-one |
---|
Frequency | 101.1 |
---|
Structure | |
---|
Chemical Formula | C15H14O6 |
---|
Molecular Mass | 290.079 |
---|
SMILES | CC(C(=O)c1c(O)cc(O)c(O)c1O)c1ccc(O)cc1 |
---|
InChI Key | NMWHCGUTYCBKPP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | alpha-methyldeoxybenzoin flavonoids |
---|
Subclass | alpha-methyldeoxybenzoin flavonoids |
---|
Direct Parent | alpha-methyldeoxybenzoin flavonoids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenylpropanesstilbenesvinylogous acids |
---|
Substituents | acylphloroglucinol derivativemonocyclic benzene moietyaryl alkyl ketonebenzenetriolbenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphenylketonealpha-methyldeoxybenzoin flavonoidketonephenylpropanephloroglucinol derivativearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
---|