| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:40 UTC |
|---|
| Update Date | 2025-03-21 18:01:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035324 |
|---|
| Frequency | 133.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9N3O3 |
|---|
| Molecular Mass | 195.0644 |
|---|
| SMILES | N=C(N)Nc1ccc(O)c(C(=O)O)c1 |
|---|
| InChI Key | SRSKDGMZQFDULZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | guanidinobenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativescarboximidamidesguanidineshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundssalicylic acidsvinylogous acids |
|---|
| Substituents | carboxylic acidguanidineiminebenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidcarboximidamidehydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesphenolhydrocarbon derivativeguanidinobenzoic acid or derivativesorganic nitrogen compoundorganooxygen compound |
|---|
