Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:48:42 UTC |
---|
Update Date | 2025-03-21 18:01:54 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00035406 |
---|
Frequency | 115.4 |
---|
Structure | |
---|
Chemical Formula | C23H25N7O4 |
---|
Molecular Mass | 463.1968 |
---|
SMILES | Nc1nc(=O)c2c([nH]1)NCC(CNc1ccc(C(=O)NC(Cc3ccccc3)C(=O)O)cc1)N2 |
---|
InChI Key | LGWIDNWTOZOBAN-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | phenylalanine and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | alpha amino acidsamino acidsamphetamines and derivativesazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshippuric acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsphenylalkylaminesphenylpropanoic acidsprimary aminespterins and derivativespyrimidonessecondary alkylarylaminessecondary carboxylic acid amidesvinylogous amides |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidamino acidbenzoylpyrimidonebenzamidepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesvinylogous amidepterinazacyclen-acyl-alpha-amino acidhippuric acid or derivativesheteroaromatic compoundbenzoic acid or derivativessecondary aminecarboxamide groupsecondary aliphatic/aromatic aminesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
---|