| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:42 UTC |
|---|
| Update Date | 2025-03-21 18:01:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035417 |
|---|
| Frequency | 105.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N2O5 |
|---|
| Molecular Mass | 228.0746 |
|---|
| SMILES | O=c1ncc(C2OC(CO)C(O)C2O)c[nH]1 |
|---|
| InChI Key | AKWKAAFZXAQGAN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholethercarbonic acid derivativearomatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharidepyrimidonedialkyl etheroxacyclesaccharideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|
