| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:42 UTC |
|---|
| Update Date | 2025-03-21 18:01:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035429 |
|---|
| Frequency | 100.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H6O5 |
|---|
| Molecular Mass | 194.0215 |
|---|
| SMILES | O=C(O)C(=O)CC1=CC(=O)C(=O)C=C1 |
|---|
| InChI Key | YFEIEGRJVFMIQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | quinones |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativeso-benzoquinonesorganic oxides |
|---|
| Substituents | carboxylic acido-benzoquinonealpha-hydroxy ketonecarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesketo acidalpha-keto acidaliphatic homomonocyclic compoundhydrocarbon derivativequinone |
|---|
