| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:48:43 UTC |
|---|
| Update Date | 2025-03-21 18:01:55 UTC |
|---|
| HMDB ID | HMDB0001235 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035459 |
|---|
| Name | 5-Aminoimidazole ribonucleotide |
|---|
| Frequency | 100.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14N3O7P |
|---|
| Molecular Mass | 295.0569 |
|---|
| SMILES | Nc1cncn1C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | PDACUKOKVHBVHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazole ribonucleosides and ribonucleotidesimidazolesmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminessecondary alcoholstetrahydrofurans |
|---|
| Substituents | imidazole ribonucleosidearomatic heteromonocyclic compoundpentose phosphatepentose-5-phosphateorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|
