| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:48:44 UTC |
|---|
| Update Date | 2025-03-21 18:01:55 UTC |
|---|
| HMDB ID | HMDB0245782 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035491 |
|---|
| Name | 3-(4-Hydroxyphenoxy)benzoic acid |
|---|
| Frequency | 100.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O4 |
|---|
| Molecular Mass | 230.0579 |
|---|
| SMILES | O=C(O)c1cccc(Oc2ccc(O)cc2)c1 |
|---|
| InChI Key | OSGCDVKVZWMYBG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativescarboxylic acidsdiarylethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etherethercarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzoic acidphenoxy compounddiphenyletherorganooxygen compound |
|---|
