| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:49 UTC |
|---|
| Update Date | 2025-03-21 18:01:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035695 |
|---|
| Frequency | 99.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15NO7 |
|---|
| Molecular Mass | 249.0849 |
|---|
| SMILES | NC1C(O)C=C(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | FCPYDHZOFFVRHL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | secondary alcohols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundprimary alcoholorganoheterocyclic compound |
|---|
