| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:53 UTC |
|---|
| Update Date | 2025-03-21 18:01:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035835 |
|---|
| Frequency | 99.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO3 |
|---|
| Molecular Mass | 285.1365 |
|---|
| SMILES | COc1ccc2c3c1OC1C(O)C=CC4C(C2)N(C)CC341 |
|---|
| InChI Key | DXRCOZSLOKRJLN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsazepinesbenzazepinescoumaranshydrocarbon derivativesisoindolesisoindolinesn-alkylpyrrolidinesorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretheralkyl aryl etherisoindolinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinetertiary amineorganoheterocyclic compoundcoumaranalcoholphenanthreneazacyclen-alkylpyrrolidineisoindoletertiary aliphatic amineoxacycleorganic oxygen compoundazepineanisoleisoindole or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compoundbenzazepineamineorganooxygen compound |
|---|
