| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:53 UTC |
|---|
| Update Date | 2025-03-21 18:01:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035845 |
|---|
| Frequency | 114.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O4 |
|---|
| Molecular Mass | 253.0811 |
|---|
| SMILES | Nc1nc(O)nc2ncc(C(O)C(O)CO)nc12 |
|---|
| InChI Key | AICPTHHAKMWBMI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidolactamsorganopnictogen compoundsprimary alcoholsprimary aminespyrazinessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholazacycleheteroaromatic compoundhydroxypyrimidinepteridinepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compound |
|---|
