| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:53 UTC |
|---|
| Update Date | 2025-03-21 18:02:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035867 |
|---|
| Frequency | 99.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O6 |
|---|
| Molecular Mass | 300.0634 |
|---|
| SMILES | COc1cc2occ(-c3ccc(O)c(O)c3)c(=O)c2cc1O |
|---|
| InChI Key | QBTQDJARMLYKGZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | o-methylated isoflavonoids |
|---|
| Direct Parent | 7-o-methylisoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesisoflavonoidsorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound7-o-methylisoflavoneisoflavonebenzopyranheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundpyrananisolephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
