| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:56 UTC |
|---|
| Update Date | 2025-03-21 18:02:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035951 |
|---|
| Frequency | 98.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N4O8S |
|---|
| Molecular Mass | 348.0376 |
|---|
| SMILES | O=S(=O)(O)Oc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
|---|
| InChI Key | DMPAPDQOQINZMI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | arylsulfatesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | sulfuric acid monoestermonosaccharideimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundarylsulfateprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholorganic sulfuric acid or derivativesazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativepurineorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|