| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:48:56 UTC |
|---|
| Update Date | 2025-03-21 18:02:02 UTC |
|---|
| HMDB ID | HMDB0041687 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00035988 |
|---|
| Name | 5,6,7,3',4'-Pentahydroxyisoflavone |
|---|
| Frequency | 98.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O7 |
|---|
| Molecular Mass | 302.0427 |
|---|
| SMILES | O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)c(O)c(O)c12 |
|---|
| InChI Key | BIDDAFIPYBBDES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | isoflavonemonocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|