Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:48:58 UTC |
---|
Update Date | 2025-03-21 18:02:02 UTC |
---|
HMDB ID | HMDB0245294 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00036072 |
---|
Name | 2-Phenylindole |
---|
Frequency | 98.3 |
---|
Structure | |
---|
Chemical Formula | C14H11N |
---|
Molecular Mass | 193.0891 |
---|
SMILES | c1ccc(-c2cc3ccccc3[nH]2)cc1 |
---|
InChI Key | KLLLJCACIRKBDT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | indoles and derivatives |
---|
Subclass | indoles |
---|
Direct Parent | indoles |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganonitrogen compoundsorganopnictogen compoundspyrroles |
---|
Substituents | monocyclic benzene moietyazacycleindoleheteroaromatic compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compound |
---|