| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:48:59 UTC |
|---|
| Update Date | 2025-03-21 18:02:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036076 |
|---|
| Frequency | 98.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O6 |
|---|
| Molecular Mass | 290.079 |
|---|
| SMILES | O=C(c1c(O)cc(O)cc1O)C(CO)c1ccc(O)cc1 |
|---|
| InChI Key | YCMPGVMEGZDOKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbeta-hydroxy ketoneshydrocarbon derivativesorganic oxidesprimary alcoholsvinylogous acids |
|---|
| Substituents | beta-hydroxy ketonemonocyclic benzene moietyaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidketonephloroglucinol derivativeorganic oxideprimary alcoholacylphloroglucinol derivativealcoholbenzenetriol1-hydroxy-4-unsubstituted benzenoidphenylketonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|
