| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:01 UTC |
|---|
| Update Date | 2025-03-21 18:02:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036175 |
|---|
| Frequency | 98.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O10S |
|---|
| Molecular Mass | 271.9838 |
|---|
| SMILES | O=C(O)CC(O)(CC(=O)OS(=O)(=O)O)C(=O)O |
|---|
| InChI Key | HWPPBMDRBBZDLG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxidessulfuric acid monoesterstertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundsulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativesalpha-hydroxy acidtricarboxylic acid or derivativeshydroxy acidtertiary alcoholorganic oxideorganic oxygen compoundhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
