| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:49:01 UTC |
|---|
| Update Date | 2025-03-21 18:02:03 UTC |
|---|
| HMDB ID | HMDB0011684 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036188 |
|---|
| Name | N(6)-(Octanoyl)lysine |
|---|
| Frequency | 97.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H28N2O3 |
|---|
| Molecular Mass | 272.21 |
|---|
| SMILES | CCCCCCCC(=O)NCCCCC(N)C(=O)O |
|---|
| InChI Key | DUZODDYGMSCYMJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amino fatty acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmedium-chain fatty acidsmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty amidefatty acidcarboxamide groupamino fatty acidn-acyl-aminesecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativemedium-chain fatty acidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
