| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:04 UTC |
|---|
| Update Date | 2025-03-21 18:02:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036313 |
|---|
| Frequency | 97.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H20N4O5 |
|---|
| Molecular Mass | 360.1434 |
|---|
| SMILES | Cc1cc2nc3c(=O)ncnc-3n(CC(O)C(O)C(O)CO)c2cc1C |
|---|
| InChI Key | CXKWHJNRLVNFHI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrazinespyrimidonesquinoxalinessecondary alcohols |
|---|
| Substituents | alcoholquinoxalineazacycleheteroaromatic compoundpyrimidonepteridinepyrimidineorganic oxideorganic oxygen compounddiazanaphthalenearomatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|
