| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:04 UTC |
|---|
| Update Date | 2025-03-21 18:02:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036323 |
|---|
| Frequency | 97.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H34N4O4S |
|---|
| Molecular Mass | 462.2301 |
|---|
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)C(C)N)S(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | MUVRJUNNMPFGIQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alanine and derivativesalpha amino acidsaminosulfonyl compoundsamphetamines and derivativesbenzenesulfonamidesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganopnictogen compoundsorganosulfonamidesphenylbutylaminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietycarbonyl grouporganosulfur compoundorganosulfonic acid amideorganic oxidephenylbutylamineorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesbenzenesulfonyl groupalcoholbenzenesulfonamidealpha-amino acid amideaminosulfonyl compoundcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholalanine or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
