| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:06 UTC |
|---|
| Update Date | 2025-03-21 18:02:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036383 |
|---|
| Frequency | 97.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H22NO11P |
|---|
| Molecular Mass | 375.093 |
|---|
| SMILES | CC(=O)NC1C(OP(=O)(O)OCC(O)CO)OC(CO)C(O)C1O |
|---|
| InChI Key | NPJNVDJOHALAMD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycosylglycerophospholipids |
|---|
| Direct Parent | glycosylglycerophospholipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativesdialkyl phosphateshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosaminesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholglycosylglycerophosphate-skeletoncarboxamide groupoxacyclesecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|