| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:49:06 UTC |
|---|
| Update Date | 2025-03-21 18:02:07 UTC |
|---|
| HMDB ID | HMDB0128077 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036391 |
|---|
| Name | 3-phenyl-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
|---|
| Frequency | 97.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O4 |
|---|
| Molecular Mass | 256.0736 |
|---|
| SMILES | O=C(C=Cc1ccccc1)c1c(O)cc(O)cc1O |
|---|
| InChI Key | LOYXTWZXLWHMBX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | cinnamylphenols |
|---|
| Direct Parent | cinnamylphenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalpha,beta-unsaturated ketonesaryl ketonesbenzoyl derivativescinnamic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsvinylogous acids |
|---|
| Substituents | acylphloroglucinol derivativemonocyclic benzene moietybenzenetriolbenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenol1-hydroxy-4-unsubstituted benzenoidalpha,beta-unsaturated ketoneketonephloroglucinol derivativearomatic homomonocyclic compoundvinylogous acidcinnamic acid or derivativesorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
