| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:09 UTC |
|---|
| Update Date | 2025-03-21 18:02:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036518 |
|---|
| Frequency | 96.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N3O8P |
|---|
| Molecular Mass | 321.0362 |
|---|
| SMILES | Nc1ccn(C2OC(CO)C3OOP(=O)(O)OC32)c(=O)n1 |
|---|
| InChI Key | WGVIPJPGOBYOCJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminestetrahydrofurans |
|---|
| Substituents | alcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundpyrimidoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholimidolactamorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
