Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:49:09 UTC |
---|
Update Date | 2025-03-21 18:02:08 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00036538 |
---|
Frequency | 96.8 |
---|
Structure | |
---|
Chemical Formula | C12H16N2O3 |
---|
Molecular Mass | 236.1161 |
---|
SMILES | CN(CC(=O)O)C(=O)C(N)Cc1ccccc1 |
---|
InChI Key | GXPXVNNQIQAOBT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | peptidomimetics |
---|
Subclass | peptoid-peptide hybrids |
---|
Direct Parent | peptoid-peptide hybrids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdipeptideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativestertiary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativespeptoid/peptide hybridalpha-amino acid amiden-acyl-alpha-amino acidcarboxamide grouparomatic homomonocyclic compoundalpha-dipeptidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|