| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:11 UTC |
|---|
| Update Date | 2025-03-21 18:02:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036605 |
|---|
| Frequency | 96.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H28N2O |
|---|
| Molecular Mass | 324.2202 |
|---|
| SMILES | CN(C)CCCC(C(=O)N(C)C)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | CJKLVUKXLSCBNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic oxidesorganopnictogen compoundsphenylacetamidesphenylbutylaminestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl groupamino acid or derivativestertiary aliphatic aminecarboxamide groupcarboxylic acid derivativen-acyl-aminearomatic homomonocyclic compoundorganic oxidephenylbutylamineorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminephenylacetamidetertiary amineorganooxygen compound |
|---|