| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:12 UTC |
|---|
| Update Date | 2025-03-21 18:02:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036624 |
|---|
| Frequency | 96.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO5S |
|---|
| Molecular Mass | 255.0201 |
|---|
| SMILES | COS(=O)(=O)Oc1ccc2cccc(O)c2n1 |
|---|
| InChI Key | HUOYRJVOQCGLPE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | quinolones and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-halopyridines8-hydroxyquinolinesalkyl sulfatesarylsulfatesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinessulfuric acid diesters |
|---|
| Substituents | polyhalopyridine1-hydroxy-2-unsubstituted benzenoidorganic oxidesulfuric acid diesteraromatic heteropolycyclic compoundalkyl sulfateorganonitrogen compoundorganopnictogen compoundarylsulfate2-halopyridinequinoloneorganic sulfuric acid or derivatives8-hydroxyquinolineazacycleheteroaromatic compoundhydroxypyridinemethylpyridine1-hydroxy-4-unsubstituted benzenoidpyridineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
