Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:49:12 UTC |
---|
Update Date | 2025-03-21 18:02:09 UTC |
---|
HMDB ID | HMDB0041732 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00036645 |
---|
Name | Equol 7-O-glucuronide |
---|
Frequency | 96.4 |
---|
Structure | |
---|
Chemical Formula | C21H22O9 |
---|
Molecular Mass | 418.1264 |
---|
SMILES | O=C(O)C1OC(Oc2ccc3c(c2)OCC(c2ccc(O)cc2)C3)C(O)C(O)C1O |
---|
InChI Key | XDPLKWRSVXUQBN-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflavonoid o-glycosides |
---|
Direct Parent | isoflavonoid o-glycosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsacetalsalkyl aryl ethersbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesisoflavanolsmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidssecondary alcohols |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidglucuronic acid or derivatives1-benzopyranisoflavanolo-glucuronide1-hydroxy-2-unsubstituted benzenoidisoflavonoid-7-o-glycosidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundchromaneoxaneorganoheterocyclic compoundalcoholisoflavanbenzopyranpyran carboxylic acid or derivativesisoflavonoid o-glycosidehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|