| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:16 UTC |
|---|
| Update Date | 2025-03-21 18:02:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036802 |
|---|
| Frequency | 95.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N5O6P |
|---|
| Molecular Mass | 331.0682 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(O)C1OP(=O)(O)O |
|---|
| InChI Key | MGROTJUPKSTMRS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-substituted cyclopentyl purine nucleosidesazacyclic compoundscyclitols and derivativescyclopentanolsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic oxidesorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivatives |
|---|
| Substituents | imidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolecyclopentyl nucleosidealcoholazacycleheteroaromatic compoundcyclitol or derivativescyclic alcoholcyclopentanol1,3-substituted cyclopentyl purine nucleosideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|