| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:49:18 UTC |
|---|
| Update Date | 2025-03-21 18:02:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00036901 |
|---|
| Frequency | 95.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9O6P |
|---|
| Molecular Mass | 232.0137 |
|---|
| SMILES | O=C(O)c1ccc(COP(=O)(O)O)cc1 |
|---|
| InChI Key | AOKKTQMTVOCYLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | carboxylic acidbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativebenzoic acidorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|